For research use only. Not for therapeutic Use.
ER-27319 maleate(CAT: I010559) is a high-affinity, selective sigma-1 receptor agonist, known for its potential neuroprotective and neuromodulatory effects. The sigma-1 receptor is involved in regulating calcium signaling, neuroplasticity, and neurotransmitter release, making it a key target in treating neurodegenerative diseases and psychiatric disorders. ER-27319 maleate has been studied for its role in enhancing cognitive function, protecting against neurotoxicity, and modulating pain perception. Given its mechanism of action, ER-27319 maleate is most relevant to Neurological Disease Research, particularly in the study of Alzheimer’s disease, Parkinson’s disease, depression, and neuropathic pain.
| Catalog Number | I010559 |
| CAS Number | 1204480-26-1 |
| Synonyms | 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;(Z)-but-2-enedioic acid |
| Molecular Formula | C22H24N2O5 |
| Purity | ≥95% |
| IUPAC Name | 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;(Z)-but-2-enedioic acid |
| InChI | InChI=1S/C18H20N2O.C4H4O4/c1-12-8-9-15-17(13(12)2)20(11-5-10-19)16-7-4-3-6-14(16)18(15)21;5-3(6)1-2-4(7)8/h3-4,6-9H,5,10-11,19H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WVUQPGFRFBVJKH-BTJKTKAUSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3N2CCCN)C.C(=CC(=O)O)C(=O)O |
