For research use only. Not for therapeutic Use.
ERAP2-IN-1（Cat No.:I043339）is a small molecule inhibitor designed to target ERAP2 (Endoplasmic Reticulum Aminopeptidase 2), an enzyme involved in processing peptides for presentation on MHC class I molecules, which play a crucial role in immune system function. By inhibiting ERAP2, ERAP2-IN-1 aims to modulate the immune response, potentially offering therapeutic benefits in autoimmune diseases, cancer, or inflammatory conditions. Disrupting peptide processing could influence how the immune system recognizes and responds to pathogens or tumor cells. Ongoing research is focused on evaluating its efficacy, safety, and potential applications in immunotherapy.
| CAS Number | 2420551-38-6 |
| Synonyms | 4-methoxy-3-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
| Molecular Formula | C20H21F3N2O5S |
| Purity | ≥95% |
| IUPAC Name | 4-methoxy-3-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
| InChI | InChI=1S/C20H21F3N2O5S/c1-30-17-8-5-13(19(26)27)11-18(17)31(28,29)24-15-7-6-14(20(21,22)23)12-16(15)25-9-3-2-4-10-25/h5-8,11-12,24H,2-4,9-10H2,1H3,(H,26,27) |
| InChIKey | BGLAMEXMBJAJBI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC2=C(C=C(C=C2)C(F)(F)F)N3CCCCC3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
