For research use only. Not for therapeutic Use.
Ercalcidiol-d3(Cat No.:S000546) is a specialized form of ercalcidiol, also known as 25-hydroxyvitamin D3, a major circulating metabolite of vitamin D. The “d3” designation indicates that three hydrogen atoms in the ercalcidiol molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling facilitates precise tracking of ercalcidiol metabolism and its pharmacokinetics using advanced analytical techniques like mass spectrometry. Ercalcidiol-d3 serves as a valuable tool in clinical and pharmacological studies, aiding in elucidating vitamin D metabolism, understanding its bioavailability, and investigating its role in various health conditions, including bone health and immune function.
CAS Number | 1217467-39-4 |
Molecular Formula | C28H41D3O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-deuterioethylidene]-4-(dideuteriomethylidene)cyclohexan-1-ol |
InChI | InChI=1S/C28H44O2/c1-19-10-14-24(29)18-23(19)13-12-22-8-7-17-28(6)25(15-16-26(22)28)20(2)9-11-21(3)27(4,5)30/h9,11-13,20-21,24-26,29-30H,1,7-8,10,14-18H2,2-6H3/b11-9?,22-12+,23-13+/t20-,21+,24+,25-,26+,28-/m1/s1/i1D2,13D |
InChIKey | KJKIIUAXZGLUND-ABHIMYCLSA-N |
SMILES | CC(C=CC(C)C(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |