For research use only. Not for therapeutic Use.
ERCC1-XPF-IN-2（Cat No.:I043373）is a small molecule inhibitor designed to target the ERCC1-XPF complex, which plays a key role in DNA repair, particularly in the nucleotide excision repair (NER) pathway. This complex is essential for repairing DNA damage caused by factors like UV radiation and chemotherapy drugs. By inhibiting ERCC1-XPF, ERCC1-XPF-IN-2 aims to sensitize cancer cells to DNA-damaging therapies, potentially enhancing the effectiveness of chemotherapy and radiation treatments. Ongoing research is focused on evaluating its potential to improve cancer treatment outcomes by overcoming resistance to standard therapies.
| CAS Number | 1808986-37-9 |
| Synonyms | 2-(2,4-dichlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]acetamide |
| Molecular Formula | C15H13Cl2NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]acetamide |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-3-2-10(12(17)7-11)6-15(21)18-8-9-1-4-13(19)14(20)5-9/h1-5,7,19-20H,6,8H2,(H,18,21) |
| InChIKey | BKPCQXGBKRAJDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CNC(=O)CC2=C(C=C(C=C2)Cl)Cl)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
