For research use only. Not for therapeutic Use.
Ergosterol peroxide(Cat No.:R011130)is a naturally occurring steroid derivative with notable bioactive properties, found in fungi and certain plants. Known for its anti-inflammatory, antioxidant, and anticancer effects, ergosterol peroxide has gained attention in pharmacological research. It inhibits tumor cell growth and induces apoptosis, making it a potential candidate in cancer treatment studies. Additionally, its antimicrobial activity has shown effectiveness against various pathogens. Ergosterol peroxide’s multifaceted bioactivities, particularly its immune-modulating and cytotoxic properties, highlight its potential as a therapeutic agent in oncology and infectious disease research.
Catalog Number | R011130 |
CAS Number | 2061-64-5 |
Molecular Formula | C28H44O3 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | (1S,2R,5R,6R,9R,10R,13S,15S)-5-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-en-13-ol |
InChI | InChI=1S/C28H44O3/c1-18(2)19(3)7-8-20(4)22-9-10-23-25(22,5)13-12-24-26(6)14-11-21(29)17-27(26)15-16-28(23,24)31-30-27/h7-8,15-16,18-24,29H,9-14,17H2,1-6H3/b8-7+/t19-,20+,21-,22+,23+,24+,25+,26+,27+,28-/m0/s1 |
InChIKey | VXOZCESVZIRHCJ-KGHQQZOUSA-N |
SMILES | C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@]24C=C[C@@]5([C@@]3(CC[C@@H](C5)O)C)OO4)C |