For research use only. Not for therapeutic Use.
Eribulin（Cat No.:I002863）is a synthetic analog of halichondrin B, derived from the marine sponge Halichondria okadai. It is an antineoplastic agent used to treat metastatic breast cancer and liposarcoma. Eribulin works by inhibiting microtubule dynamics, thereby blocking cell division and inducing apoptosis in cancer cells. Its unique mechanism of action, distinct from other microtubule inhibitors, makes it effective against tumors resistant to other chemotherapies. Eribulin has shown efficacy in improving overall survival in patients with advanced cancers, making it a valuable option in oncology treatment regimens.
| Catalog Number | I002863 |
| CAS Number | 253128-41-5 |
| Molecular Formula | C40H59NO11 |
| Purity | ≥95% |
| Target | Cytoskeleton |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | (1S,3S,6S,9S,12S,14R,16R,18S,20R,21R,22S,26R,29S,31R,32S,33R,35R,36S)-20-[(2S)-3-amino-2-hydroxypropyl]-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
| InChI | InChI=1S/C40H59NO11/c1-19-11-24-5-7-28-20(2)12-26(45-28)9-10-40-17-33-36(51-40)37-38(50-33)39(52-40)35-29(49-37)8-6-25(47-35)13-22(42)14-27-31(16-30(46-24)21(19)3)48-32(34(27)44-4)15-23(43)18-41/h19,23-39,43H,2-3,5-18,41H2,1,4H3/t19-,23+,24+,25-,26+,27+,28+,29+,30-,31+,32-,33-,34-,35+,36+,37+,38-,39+,40+/m1/s1 |
| InChIKey | UFNVPOGXISZXJD-JBQZKEIOSA-N |
| SMILES | C[C@@H]1C[C@@H]2CC[C@H]3C(=C)C[C@@H](O3)CC[C@]45C[C@@H]6[C@H](O4)[C@H]7[C@@H](O6)[C@@H](O5)[C@@H]8[C@@H](O7)CC[C@@H](O8)CC(=O)C[C@H]9[C@H](C[C@H](C1=C)O2)O[C@@H]([C@@H]9OC)C[C@@H](CN)O |
