For research use only. Not for therapeutic Use.
(+)-Erinacin A(Cat No.:R030854) is a potent diterpenoid compound isolated from the medicinal mushroom Hericium erinaceus. Known for its neuroprotective properties, it promotes nerve growth factor (NGF) synthesis, which supports neuronal growth and repair. This makes (+)-Erinacin A a promising candidate for research into treatments for neurodegenerative diseases such as Alzheimer’s and Parkinson’s. Additionally, it exhibits anti-inflammatory and antioxidant activities, further enhancing its therapeutic potential. Its natural origin and multifaceted biological activities make (+)-Erinacin A a valuable compound in both medical research and the development of novel therapeutics.
CAS Number | 156101-08-5 |
Synonyms | (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carbaldehyde |
Molecular Formula | C25H36O6 |
Purity | ≥95% |
IUPAC Name | (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carbaldehyde |
InChI | InChI=1S/C25H36O6/c1-14(2)16-7-8-24(3)9-10-25(4)17(20(16)24)6-5-15(12-26)11-19(25)31-23-22(29)21(28)18(27)13-30-23/h5-6,12,14,18-19,21-23,27-29H,7-11,13H2,1-4H3/t18-,19+,21+,22-,23+,24-,25-/m1/s1 |
InChIKey | LPPCHLAEVDUIIW-NLLUTMDRSA-N |
SMILES | CC(C)C1=C2C3=CC=C(CC(C3(CCC2(CC1)C)C)OC4C(C(C(CO4)O)O)O)C=O |