For research use only. Not for therapeutic Use.
Eriocitrin(CAT: M062273) is a flavonoid glycoside, a class of compounds commonly found in various plants. It is specifically a derivative of the flavonoid called eriodictyol. Eriocitrin is commonly found in citrus fruits, such as lemons and oranges, and contributes to their characteristic flavor and aroma. This compound possesses antioxidant properties, which may have potential health benefits. Research suggests that eriocitrin may play a role in promoting cardiovascular health, reducing oxidative stress, and supporting the immune system.
CAS Number | 13463-28-0 |
Molecular Formula | C27H32O15 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
InChI | 1S/C27H32O15/c1-9-20(32)22(34)24(36)26(39-9)38-8-18-21(33)23(35)25(37)27(42-18)40-11-5-14(30)19-15(31)7-16(41-17(19)6-11)10-2-3-12(28)13(29)4-10/h2-6,9,16,18,20-30,32-37H,7-8H2,1H3/t9-,16-,18+,20-,21+,22+,23-,24+,25+,26+,27+/m0/s1 |
InChIKey | OMQADRGFMLGFJF-MNPJBKLOSA-N |
SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |