For research use only. Not for therapeutic Use.
Eriodictyol (Cat.No:R055993) is a flavonoid compound found in various plants, including citrus fruits and herbs. Known for its antioxidant and anti-inflammatory properties, eriodictyol has been studied for its potential health benefits. It shows promise in supporting cardiovascular health, immune function, and potential anticancer effects, contributing to its growing interest in research.
| Catalog Number | R055993 |
| CAS Number | 552-58-9 |
| Molecular Formula | C15H12O6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
| InChIKey | SBHXYTNGIZCORC-ZDUSSCGKSA-N |
| SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
