For research use only. Not for therapeutic Use.
Erlotinib-d6 Hydrochloride(Cat No.:R005822) is a high-purity, deuterium-labeled compound essential for advanced pharmaceutical and biochemical research. Featuring six deuterium atoms, this isotopically labeled version of Erlotinib is crucial for studies on cancer therapy, drug metabolism, and pharmacokinetics. Erlotinib-d6 Hydrochloride aids in the development of targeted cancer therapies and enhances the understanding of drug action mechanisms, making it a valuable tool for scientific investigations and drug development.
Catalog Number | R005822 |
CAS Number | 1189953-78-3 |
Synonyms | N-(3-Ethynylphenyl)-6,7-bis(2-methoxyethoxy-d3)-4-quinazolinamine Hydrochloride; 6,7-Bis(2-methoxyethoxy-d3)-4-(3-ethynylanilino)quinazoline Hydrochloride; [6,7-Bis(2-methoxyethoxy-d3)quinazolin-4-yl]-(3-ethynylphenyl)amine Hydrochloride; ?CP 358774 |
Molecular Formula | C22H24ClN3O4 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Storage | -20°C |
IUPAC Name | N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine;hydrochloride |
InChI | InChI=1S/C22H23N3O4.ClH/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22;/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25);1H/i2D3,3D3; |
InChIKey | GTTBEUCJPZQMDZ-HVTBMTIBSA-N |
SMILES | [2H]C([2H])([2H])OCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC([2H])([2H])[2H].Cl |