For research use only. Not for therapeutic Use.
ES9-17(Cat No.:I027004)is a small molecule compound being studied for its potential applications in cancer research. It targets specific cellular pathways involved in tumor growth, proliferation, and survival. ES9-17 works by inhibiting key proteins or enzymes that contribute to cancer cell resistance to treatment, making it a promising candidate for overcoming therapeutic resistance. In preclinical studies, ES9-17 has shown the potential to inhibit the growth of certain cancer types. Ongoing research is focused on evaluating its safety, pharmacokinetics, and efficacy in clinical trials to determine its suitability for use in cancer therapies.
CAS Number | 55854-43-8 |
Synonyms | 5-bromo-N-phenylthiophene-2-sulfonamide |
Molecular Formula | C10H8BrNO2S2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-N-phenylthiophene-2-sulfonamide |
InChI | InChI=1S/C10H8BrNO2S2/c11-9-6-7-10(15-9)16(13,14)12-8-4-2-1-3-5-8/h1-7,12H |
InChIKey | AIZXCKZVUXCHAP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(S2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |