For research use only. Not for therapeutic Use.
ESI-09（Cat No.:I002904）is a selective inhibitor of the Epac (Exchange Protein directly Activated by cAMP) pathway, specifically targeting Epac1 and Epac2, key regulators in cellular signaling. By blocking Epac-mediated cAMP signaling, ESI-09 is widely used in research to explore its roles in inflammation, cancer, and cardiovascular disease. Its specificity makes it valuable for dissecting cAMP-related pathways without affecting PKA (Protein Kinase A), another cAMP-dependent pathway. ESI-09 aids studies aiming to better understand Epac functions, offering insights into potential therapeutic strategies targeting cAMP signaling in various diseases.
| Catalog Number | I002904 |
| CAS Number | 263707-16-0 |
| Synonyms | α-[2-(3-chlorophenyl)hydrazinylidene]-5-(1,1-dimethylethyl)-β-oxo-3-isoxazolepropanenitrile |
| Molecular Formula | C16H15ClN4O2 |
| Purity | ≥95% |
| Target | Virus Protease |
| Solubility | DMSO: ≥ 47 mg/mL |
| Storage | -20°C |
| IC50 | 1.4 uM/3.2 uM(EPAC2/EPAC1, cAMP-mediated EPAC1/2 GEF activity) |
| IUPAC Name | (1E)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(3-chloroanilino)-2-oxoethanimidoyl cyanide |
| InChI | InChI=1S/C16H15ClN4O2/c1-16(2,3)14-8-12(21-23-14)15(22)13(9-18)20-19-11-6-4-5-10(17)7-11/h4-8,19H,1-3H3/b20-13+ |
| InChIKey | DXEATJQGQHDURZ-DEDYPNTBSA-N |
| SMILES | CC(C)(C)C1=CC(=NO1)C(=O)/C(=N/NC2=CC(=CC=C2)Cl)/C#N |
| Reference | 1: Wang X, Luo C, Cheng X, Lu M. Lithium and an EPAC-specific inhibitor ESI-09 <br> <br> |
