For research use only. Not for therapeutic Use.
Esomeprazole（Cat No.:M023483）, is a proton pump inhibitor (PPI) medication used to treat various gastrointestinal conditions, particularly gastroesophageal reflux disease (GERD), peptic ulcers, and Zollinger-Ellison syndrome. It works by reducing the production of stomach acid by inhibiting the proton pump in the stomach lining, thus providing relief from acid-related symptoms and promoting healing of the esophagus and stomach lining. Esomeprazole is often prescribed as an effective treatment for heartburn, acid reflux, and ulcers.
| Catalog Number | M023483 |
| CAS Number | 119141-88-7 |
| Molecular Formula | C17H19N3O3S |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | Room Temperature |
| IUPAC Name | 6-methoxy-2-[(S)-(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole |
| InChI | InChI=1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20)/t24-/m0/s1 |
| InChIKey | SUBDBMMJDZJVOS-DEOSSOPVSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |
