For research use only. Not for therapeutic Use.
Estra-5(10),9(11)-diene-3,17-dione 3-Ethylene Ketal is a steroid derivative characterized by a unique diene structure and an ethylene ketal moiety. This compound is of interest in the field of medicinal chemistry due to its potential hormonal activity and application in hormone replacement therapies. The ethylene ketal protects the ketone functionalities, enhancing stability and selectivity in biological interactions. Research into this compound focuses on its effects on estrogen and androgen receptors, contributing to understanding its role in treating hormone-related disorders. Additionally, its structure allows for further modifications, paving the way for the development of novel therapeutic agents in steroid chemistry.
CAS Number | 5571-36-8 |
Synonyms | 3,3-(Ethylenedioxy)estra-5(10),9(11)-dien-17-one; Cyclic 3-(1,2-Ethanediyl Acetal)-estra-5(10),9(11)-diene-3,17-dione; |
Molecular Formula | C20H26O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (8S,13S,14S)-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2/'-1,3-dioxolane]-17-one |
InChI | InChI=1S/C20H26O3/c1-19-8-6-15-14-7-9-20(22-10-11-23-20)12-13(14)2-3-16(15)17(19)4-5-18(19)21/h6,16-17H,2-5,7-12H2,1H3/t16-,17+,19+/m1/s1 |
InChIKey | XUOQKQRMICQUQC-AOIWGVFYSA-N |
SMILES | CC12CC=C3C(C1CCC2=O)CCC4=C3CCC5(C4)OCCO5 |