Estradiol-13C2(Cat No.:S000865) is a stable isotope-labeled form of estradiol, where two carbon atoms are enriched with the 13C isotope, resulting in the molecular formula C1613C2H24O2. This labeled compound is primarily used in analytical chemistry, especially in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, to study estrogen metabolism and its biological effects with enhanced accuracy and specificity. Estradiol-13C2 is crucial in pharmaceutical research and clinical diagnostics, aiding in the development of hormonal therapies and in understanding estrogen’s role in various physiological and pathological processes, such as reproductive health and cancer.
Catalog Number | S000865 |
CAS Number | 82938-05-4 |
Molecular Formula | C1613C2H24O2 |
Purity | 95% |
IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i10+1,12+1 |
InChIKey | VOXZDWNPVJITMN-UDTNTQLLSA-N |
SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |