Estradiol-d5（Cat No.:S000854） is a deuterated form of estradiol, where five hydrogen atoms are replaced with deuterium, enhancing its molecular formula to C18H19D5O2. This stable isotope-labeled compound is crucial in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, providing enhanced detection and precise quantification in the study of estrogen metabolism. Estradiol-d5 is widely used in pharmaceutical and biomedical research, particularly in hormone-related studies, to understand the pharmacokinetics and dynamics of estrogen within the body. It is invaluable in developing therapies for conditions influenced by estrogen levels, such as breast cancer and menopausal symptoms.
| Catalog Number | S000854 |
| CAS Number | 221093-45-4 |
| Molecular Formula | C18H19D5O2 |
| Purity | ≥95% |
| IUPAC Name | (8R,9S,13S,14S,17S)-2,4,16,16,17-pentadeuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i3D,7D2,10D,17D |
| InChIKey | VOXZDWNPVJITMN-MOKSCAJFSA-N |
| SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
