For research use only. Not for therapeutic Use.
Estratetraenolis a synthetic derivative of estradiol, a crucial estrogen hormone. It interacts with estrogen receptors in tissues like the breast, uterus, bone, and brain, influencing various physiological processes. Its effects, ranging from reproductive tissue development to secondary sexual characteristics, are context-dependent, determined by factors like dosage and formulation. Widely used in research and pharmaceuticals.
| Catalog Number | R013850 |
| CAS Number | 1150-90-9 |
| Synonyms | Estra-1,3,5(10)-16-tetraen-3-ol; Compound 742; |
| Molecular Formula | C18H22O |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | (8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C18H22O/c1-18-9-2-3-17(18)16-6-4-12-11-13(19)5-7-14(12)15(16)8-10-18/h2,5,7,9,11,15-17,19H,3-4,6,8,10H2,1H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | CRMOMCHYBNOFIV-BDXSIMOUSA-N |
| SMILES | CC12CCC3C(C1CC=C2)CCC4=C3C=CC(=C4)O |
