For research use only. Not for therapeutic Use.
Etamiphylline Camsylate, also known as R-3588, is a drug used to treat chronic obstructive pulmonary disease (COPD).
| Catalog Number | I006722 |
| CAS Number | 19326-29-5 (camsilate) |
| Synonyms | Etamiphylline Camsilate; R-3588; R 3588; R3588; Milliphylline; Soluphyline; Parephyllin;;7-(2-(diethylamino)ethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione ((1S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonate |
| Molecular Formula | C23H37N5O6S |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| InChI | InChI=1S/C13H21N5O2.C10H16O4S/c1-5-17(6-2)7-8-18-9-14-11-10(18)12(19)16(4)13(20)15(11)3;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h9H,5-8H2,1-4H3;7H,3-6H2,1-2H3,(H,12,13,14)/t;7?,10-/m.1/s1 |
| InChIKey | KVZYKZBYZVKXNI-FHIDHQGESA-N |
| SMILES | CC1(C)[C@@]2(CS(=O)(O)=O)CCC1CC2=O.O=C(N3C)N(C)C4=C(N(CCN(CC)CC)C=N4)C3=O |
| Reference | 1:Vet Rec. 1979 Jan 6;104(1):22. Nitrite toxicity in cattle and etamiphylline camsylate.Fennell C, PMID: 433104 |
