For research use only. Not for therapeutic Use.
EtDO-P4(Cat No.:I027049)is a small molecule compound often used in chemical and biological research, particularly in the study of protein interactions and cellular processes. It is a ligand that binds to specific targets, such as metal ions or proteins, to modulate their activity. EtDO-P4 is commonly employed in the investigation of DNA-binding proteins, enzyme activities, and cellular signaling pathways. Its applications span across pharmacology, biochemistry, and molecular biology, where it serves as a useful tool in studying gene expression regulation, protein stability, and cellular response to various stimuli or therapies.
CAS Number | 245329-78-6 |
Synonyms | N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]hexadecanamide |
Molecular Formula | C31H52N2O4 |
Purity | ≥95% |
IUPAC Name | N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]hexadecanamide |
InChI | InChI=1S/C31H52N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-30(34)32-27(25-33-20-15-16-21-33)31(35)26-18-19-28-29(24-26)37-23-22-36-28/h18-19,24,27,31,35H,2-17,20-23,25H2,1H3,(H,32,34)/t27-,31-/m1/s1 |
InChIKey | BBTZZVJOQCCAOR-DLFZDVPBSA-N |
SMILES | CCCCCCCCCCCCCCCC(=O)N[C@H](CN1CCCC1)[C@@H](C2=CC3=C(C=C2)OCCO3)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |