For research use only. Not for therapeutic Use.
Etebenecid is a uricosuric agents, lower uric acid levels in the body by increasing the elimination of uric acid by the kidneys, also inhibits penicillin tubular secretion.
| Catalog Number | I000798 |
| CAS Number | 1213-06-5 |
| Synonyms | 4-(diethylsulfamoyl)benzoic acid |
| Molecular Formula | C11H15NO4S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H15NO4S/c1-3-12(4-2)17(15,16)10-7-5-9(6-8-10)11(13)14/h5-8H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | UACOQEQOBAQRDQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(=O)O |
