For research use only. Not for therapeutic Use.
Ethane, 1,2-bis(p-chlorophenyl)-(Cat No.:L011659)is an organochlorine compound widely used in the synthesis of pharmaceuticals and agrochemicals. Featuring two p-chlorophenyl groups attached to an ethane backbone, this compound serves as a key intermediate in the production of various bioactive molecules. Its chlorinated aromatic rings contribute to its chemical stability and reactivity, making it valuable in the development of new chemical entities. This compound is often employed in research focused on understanding its role in the synthesis of pesticides, plastics, and other industrial chemicals.
Catalog Number | L011659 |
CAS Number | 5216-35-3 |
Molecular Formula | C14H12Cl2 |
Purity | ≥95% |
IUPAC Name | 1-chloro-4-[2-(4-chlorophenyl)ethyl]benzene |
InChI | InChI=1S/C14H12Cl2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H,1-2H2 |
InChIKey | HTHGRQSFMYIQHB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCC2=CC=C(C=C2)Cl)Cl |