For research use only. Not for therapeutic Use.
Ethane-d6 is a fully deuterated form of ethane, where all six hydrogen atoms are replaced with deuterium. This compound is commonly used in various fields of scientific research, including spectroscopy, reaction mechanism studies, and tracer studies in environmental and atmospheric sciences. The deuterium atoms provide a distinct mass difference, allowing for precise tracking in mass spectrometry and NMR spectroscopy. Ethane-d6 is particularly valuable in studying the behavior of hydrocarbons, isotope effects in chemical reactions, and in investigations of kinetic isotope effects. Its stability and purity make it a reliable tool for researchers aiming to explore the fundamental aspects of organic chemistry and related disciplines.
| Catalog Number | M121229 |
| CAS Number | 1632-99-1 |
| Molecular Formula | C2H6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,1,1,2,2,2-hexadeuterioethane |
| InChI | InChI=1S/C2H6/c1-2/h1-2H3/i1D3,2D3 |
| InChIKey | OTMSDBZUPAUEDD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[2H] |
