Ethanone, 1-(3-furanyl)- (9CI)(Cat No.:M062592)is an organic compound featuring a furan ring attached to an ethanone moiety. This compound is used in pharmaceutical and chemical research as an intermediate in the synthesis of various bioactive molecules. Its unique structure allows for versatile chemical reactions, making it valuable in the development of potential therapeutic agents, including anti-inflammatory and antimicrobial drugs. The presence of the furan ring enhances its reactivity, making Ethanone, 1-(3-furanyl)- (9CI) a key building block for medicinal chemists exploring new drug discovery pathways.
Catalog Number | M062592 |
CAS Number | 14313-09-8 |
Molecular Formula | C6H6O2 |
Purity | 95% |
IUPAC Name | 1-(furan-3-yl)ethanone |
InChI | InChI=1S/C6H6O2/c1-5(7)6-2-3-8-4-6/h2-4H,1H3 |
InChIKey | GCCKHXWBNPBUOD-UHFFFAOYSA-N |
SMILES | CC(=O)C1=COC=C1 |