For research use only. Not for therapeutic Use.
Ethidium homodimer(Cat No.:R072019)is a fluorescent dye commonly used in molecular biology for detecting and quantifying DNA. It binds to double-stranded DNA, intercalating between the base pairs and emitting a strong red fluorescence when exposed to ultraviolet light. Due to its high affinity for nucleic acids, it is often used in DNA quantification, cell viability assays, and studies of apoptosis or DNA damage. Ethidium homodimer is particularly useful in identifying dead or compromised cells, as it can penetrate cell membranes that are damaged, making it a valuable tool in cellular and molecular research.
CAS Number | 61926-22-5 |
Synonyms | 5-[3-[2-[3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propylamino]ethylamino]propyl]-6-phenylphenanthridin-5-ium-3,8-diamine;dichloride;dihydrochloride |
Molecular Formula | C46H50Cl4N8 |
Purity | ≥95% |
IUPAC Name | 5-[3-[2-[3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propylamino]ethylamino]propyl]-6-phenylphenanthridin-5-ium-3,8-diamine;dichloride;dihydrochloride |
InChI | InChI=1S/C46H46N8.4ClH/c47-33-13-17-37-39-19-15-35(49)29-43(39)53(45(41(37)27-33)31-9-3-1-4-10-31)25-7-21-51-23-24-52-22-8-26-54-44-30-36(50)16-20-40(44)38-18-14-34(48)28-42(38)46(54)32-11-5-2-6-12-32;;;;/h1-6,9-20,27-30,49-52H,7-8,21-26,47-48H2;4*1H |
InChIKey | ZKAJUKABUUJRLB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C3C=C(C=CC3=C4C=CC(=CC4=[N+]2CCCNCCNCCC[N+]5=C6C=C(C=CC6=C7C=CC(=CC7=C5C8=CC=CC=C8)N)N)N)N.Cl.Cl.[Cl-].[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |