For research use only. Not for therapeutic Use.
Ethion monoxon（Cat No.:M075923） is a metabolite of ethion, an organophosphate insecticide commonly used in agricultural settings. Formed through the oxidation of ethion, ethion monoxon retains insecticidal properties but exhibits altered toxicity compared to its parent compound. It is considered more potent than ethion and may persist in the environment for an extended period. Ethion monoxon poses risks to non-target organisms and ecosystems due to its potential for bioaccumulation and environmental persistence.
| CAS Number | 17356-42-2 |
| Synonyms | ETHION MONOXON |
| Molecular Formula | C9H22O5P2S3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diethoxyphosphorylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| InChI | InChI=1S/C9H22O5P2S3/c1-5-11-15(10,12-6-2)18-9-19-16(17,13-7-3)14-8-4/h5-9H2,1-4H3 |
| InChIKey | QPNPEPLJFIUWDM-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SCSP(=S)(OCC)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
