For research use only. Not for therapeutic Use.
Ethiprole is a potent insecticide used in agricultural and pest control research. It acts on the central nervous system of insects, offering effective control of various pests. This compound is essential for developing integrated pest management strategies, ensuring minimal impact on non-target species and the environment, while providing reliable results in advanced agronomic studies.
CAS Number | 181587-01-9 |
Synonyms | Kirappu; RPA 107382; 5-Amino-1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)pyrazole-3-carbonitrile; 5-Amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)-1H-pyrazole-3-carbonitrile |
Molecular Formula | C13H9Cl2F3N4OS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfinylpyrazole-3-carbonitrile |
InChI | InChI=1S/C13H9Cl2F3N4OS/c1-2-24(23)11-9(5-19)21-22(12(11)20)10-7(14)3-6(4-8(10)15)13(16,17)18/h3-4H,2,20H2,1H3 |
InChIKey | FNELVJVBIYMIMC-UHFFFAOYSA-N |
SMILES | CCS(=O)C1=C(N(N=C1C#N)C2=C(C=C(C=C2Cl)C(F)(F)F)Cl)N |