For research use only. Not for therapeutic Use.
Ethofumesate, a chiral herbicide, acts by inhibiting mitosis and reducing photosynthesis and plant respiration[1].
| Catalog Number | R069429 |
| CAS Number | 26225-79-6 |
| Synonyms | (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methanesulfonate |
| Molecular Formula | C13H18O5S |
| Purity | ≥95% |
| InChI | InChI=1S/C13H18O5S/c1-5-16-12-13(2,3)10-8-9(18-19(4,14)15)6-7-11(10)17-12/h6-8,12H,5H2,1-4H3 |
| InChIKey | IRCMYGHHKLLGHV-UHFFFAOYSA-N |
| SMILES | CCOC1C(C2=C(O1)C=CC(=C2)OS(=O)(=O)C)(C)C |
| Reference | [1]. Perovani IS, et al. Enantioselective in vitro metabolism and in vitro-in vivo correlation of the herbicide ethofumesate in a human model. J Pharm Biomed Anal. 2020;187:113349. |
