For research use only. Not for therapeutic Use.
Ethopabate(Cat No.:R051528) is a synthetic coccidiostat and anticoccidial agent commonly used in veterinary medicine. Its action target involves inhibiting the growth and development of protozoan parasites of the genus Eimeria, which cause coccidiosis, a common intestinal infection in poultry and livestock. The mode of action includes interfering with the energy metabolism and electron transport chain of the parasites, ultimately leading to their death. Pharmacologically, ethopabate is effective against Eimeria species, preventing and controlling coccidiosis in poultry, including chickens, turkeys, and ducks, as well as in other farm animals.
CAS Number | 59-06-3 |
Synonyms | 4-Acetylamino-2-ethoxy-benzoic acid methyl ester; 4-acetamido-2-ethoxy-benzoic acid methyl ester; 4-Acetamido-2-ethoxybenzoic acid methyl ester; Methyl 4-(acetylamino)-2-ethoxybenzoate; Methyl 4-acetamido-2-ethoxybenzoate; Methyl 2-ethoxy-4-acetamido |
Molecular Formula | C₁₂H₁₅NO₄ |
Purity | ≥95% |
Target | Parasite |
Storage | Desiccate at +4C |
IUPAC Name | methyl 4-acetamido-2-ethoxybenzoate |
InChI | InChI=1S/C12H15NO4/c1-4-17-11-7-9(13-8(2)14)5-6-10(11)12(15)16-3/h5-7H,4H2,1-3H3,(H,13,14) |
InChIKey | GOVWOKSKFSBNGD-UHFFFAOYSA-N |
SMILES | CCOC1=C(C=CC(=C1)NC(=O)C)C(=O)OC |