Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl)piperidine-3-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl)piperidine-3-carboxylate(Cat No.:L033166)is a complex organic molecule, combining a piperidine structure with a boronic ester and a benzoyl group. This configuration makes it a valuable intermediate in organic synthesis, especially in Suzuki-Miyaura cross-coupling reactions used to create biologically active compounds. The boronic ester facilitates the formation of carbon-carbon bonds, critical in pharmaceutical synthesis. The piperidine and ethyl carboxylate groups enhance the solubility and reactivity of the compound, making it suitable for the development of new drugs with potential applications in various therapeutic areas.
CAS Number | 850411-14-2 |
Molecular Formula | C21H30BNO5 |
Purity | ≥95% |
IUPAC Name | ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]piperidine-3-carboxylate |
InChI | InChI=1S/C21H30BNO5/c1-6-26-19(25)16-8-7-13-23(14-16)18(24)15-9-11-17(12-10-15)22-27-20(2,3)21(4,5)28-22/h9-12,16H,6-8,13-14H2,1-5H3 |
InChIKey | YQADGHATUTVIEA-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N3CCCC(C3)C(=O)OCC |