For research use only. Not for therapeutic Use.
Ethyl 1-Boc-4-ethyl-4-piperidine carboxylate (Cat.No:M044014) is a chemical compound used in organic synthesis and pharmaceutical research. It is a versatile building block in the preparation of various drug candidates due to its unique piperidine-based structure. Ethyl 1-Boc-4-ethyl-4-piperidine carboxylate finds application in the development of potential therapeutic agents.
CAS Number | 188792-70-3 |
Molecular Formula | C15H27NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-ethylpiperidine-1,4-dicarboxylate |
InChI | InChI=1S/C15H27NO4/c1-6-15(12(17)19-7-2)8-10-16(11-9-15)13(18)20-14(3,4)5/h6-11H2,1-5H3 |
InChIKey | JLXSBKSGHPCYMR-UHFFFAOYSA-N |
SMILES | CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |