For research use only. Not for therapeutic Use.
Ethyl 1-bromo-4-oxo-4H-quinolizine-3-carboxylate(Cat No.:L032084)is a brominated heterocyclic compound used in pharmaceutical and chemical research. Featuring a bromine atom at the 1-position, a carbonyl group at the 4-position, and an ethyl ester at the 3-position on the quinolizine ring, this compound serves as a valuable intermediate for synthesizing bioactive molecules, including potential drug candidates. Its unique structure facilitates various chemical transformations, making it essential for researchers focused on developing complex organic compounds and advancing medicinal chemistry, particularly in drug discovery and development.
CAS Number | 337909-11-2 |
Molecular Formula | C12H10BrNO3 |
Purity | ≥95% |
IUPAC Name | ethyl 1-bromo-4-oxoquinolizine-3-carboxylate |
InChI | InChI=1S/C12H10BrNO3/c1-2-17-12(16)8-7-9(13)10-5-3-4-6-14(10)11(8)15/h3-7H,2H2,1H3 |
InChIKey | VEKFQNFYBWEAFJ-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=C2C=CC=CN2C1=O)Br |