For research use only. Not for therapeutic Use.
Ethyl 1-isopropyl-1H-imidazole-2-carboxylate(CAT: L000544) is a chemically important compound with applications in both organic and pharmaceutical chemistry. Its action method primarily involves its role as a valuable intermediate for the synthesis of diverse compounds. In pharmaceutical chemistry, it serves as a crucial building block for the development of potential drug candidates and bioactive molecules due to its specific structure.
| CAS Number | 2017188-77-9 |
| Molecular Formula | C9H14N2O2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 1-propan-2-ylimidazole-2-carboxylate |
| InChI | InChI=1S/C9H14N2O2/c1-4-13-9(12)8-10-5-6-11(8)7(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | MNYXTTHVOCKSHC-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
