For research use only. Not for therapeutic Use.
Ethyl 2-(2-(2-(4-chlorophenoxy)phenyl)-N-methylacetamido)acetate（Cat No.:I043115）is a chemical compound used in organic synthesis and pharmaceutical research. It consists of an ethyl ester group attached to a complex structure featuring a chlorophenyl group, a phenyl group, and a methylacetamido group. This compound is often explored for its potential bioactivity, including possible anti-inflammatory, antimicrobial, or anticancer properties. Its molecular structure allows it to interact with various biological targets, making it a candidate for the development of novel therapeutic agents.
| CAS Number | 1035404-17-1 |
| Synonyms | ethyl 2-[[2-[2-(4-chlorophenoxy)phenyl]acetyl]-methylamino]acetate |
| Molecular Formula | C19H20ClNO4 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[[2-[2-(4-chlorophenoxy)phenyl]acetyl]-methylamino]acetate |
| InChI | InChI=1S/C19H20ClNO4/c1-3-24-19(23)13-21(2)18(22)12-14-6-4-5-7-17(14)25-16-10-8-15(20)9-11-16/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | RMVRWHKAUBKLIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C)C(=O)CC1=CC=CC=C1OC2=CC=C(C=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
