For research use only. Not for therapeutic Use.
Ethyl 2-(2-Bromothiazol-5-yl)acetate(Cat No.:L039868)is a key intermediate used in pharmaceutical and chemical research, particularly in the synthesis of heterocyclic compounds. This brominated thiazole derivative is valuable for creating bioactive molecules, including potential therapeutic agents. Its structure, featuring a bromothiazole ring and an ester group, allows for versatile chemical reactions, making it essential in medicinal chemistry and drug discovery. With high purity and stability, Ethyl 2-(2-Bromothiazol-5-yl)acetate supports precise synthetic transformations, contributing to advanced research in developing new drugs and other complex organic compounds.
CAS Number | 214833-98-4 |
Molecular Formula | C7H8BrNO2S |
Purity | ≥95% |
IUPAC Name | ethyl 2-(2-bromo-1,3-thiazol-5-yl)acetate |
InChI | InChI=1S/C7H8BrNO2S/c1-2-11-6(10)3-5-4-9-7(8)12-5/h4H,2-3H2,1H3 |
InChIKey | NYDWRDWAJQLFCH-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC1=CN=C(S1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |