Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 2-(2-(dimethylamino)pyrimidin-4-yl)-1H-indole-5-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 2-(2-(dimethylamino)pyrimidin-4-yl)-1H-indole-5-carboxylate(Cat No.:L034012)is a complex organic compound used in pharmaceutical research and chemical synthesis. Featuring a dimethylamino-substituted pyrimidine ring linked to an indole carboxylate ester, this compound serves as a key intermediate in the development of novel therapeutic agents. Its unique structure allows for targeted chemical modifications, making it valuable in the synthesis of bioactive molecules. Ethyl 2-(2-(dimethylamino)pyrimidin-4-yl)-1H-indole-5-carboxylate is essential for high-precision synthesis and supports advancements in medicinal chemistry and drug discovery.
Catalog Number | L034012 |
CAS Number | 1624260-37-2 |
Molecular Formula | C17H18N4O2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-[2-(dimethylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate |
InChI | InChI=1S/C17H18N4O2/c1-4-23-16(22)11-5-6-13-12(9-11)10-15(19-13)14-7-8-18-17(20-14)21(2)3/h5-10,19H,4H2,1-3H3 |
InChIKey | JUNYLBOAWFCONB-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C3=NC(=NC=C3)N(C)C |