Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 2-(3-chloropyridin-2-yl)-5-oxopyrazolidine-3-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 2-(3-chloropyridin-2-yl)-5-oxopyrazolidine-3-carboxylate(Cat No.:L007361), is a chemical compound with significant importance in medicinal chemistry and drug development. Its molecular structure comprises a pyrazolidine ring containing a chloropyridinyl moiety and an ester functional group. This compound serves as a valuable intermediate in the synthesis of pharmaceuticals and bioactive molecules. Researchers utilize it as a building block to create diverse derivatives for the development of potential drugs. Its role in medicinal chemistry involves the exploration of structure-activity relationships and the design of novel compounds with therapeutic properties, contributing to advancements in the field of medicine and drug discovery.
CAS Number | 500011-88-1 |
Molecular Formula | C11H12ClN3O3 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(3-chloropyridin-2-yl)-5-oxopyrazolidine-3-carboxylate |
InChI | InChI=1S/C11H12ClN3O3/c1-2-18-11(17)8-6-9(16)14-15(8)10-7(12)4-3-5-13-10/h3-5,8H,2,6H2,1H3,(H,14,16) |
InChIKey | GWGIBEMOOVJUPI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CC(=O)NN1C2=C(C=CC=N2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |