For research use only. Not for therapeutic Use.
Ethyl 2-(3,4-dihydro-2H-chromen-4-yl)acetate (Cat.No:L004086) is a noteworthy chemical compound in organic synthesis. Its unique structure, containing a chromenyl moiety, imparts specialized reactivity and properties. This compound is utilized as a valuable building block in the creation of diverse functional molecules, particularly in the field of medicinal chemistry.
CAS Number | 119304-96-0 |
Molecular Formula | C13H16O3 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(3,4-dihydro-2H-chromen-4-yl)acetate |
InChI | InChI=1S/C13H16O3/c1-2-15-13(14)9-10-7-8-16-12-6-4-3-5-11(10)12/h3-6,10H,2,7-9H2,1H3 |
InChIKey | UKJHGKSYAFMJHL-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC1CCOC2=CC=CC=C12 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |