For research use only. Not for therapeutic Use.
Ethyl 2-(4-bromopyridin-2-yl)acetate(CAT: L039956) is a brominated pyridine derivative with an ethyl ester functional group. The bromine atom at the 4-position of the pyridine ring introduces reactivity that makes the compound useful for cross-coupling reactions, such as Suzuki or Buchwald-Hartwig couplings, facilitating the formation of complex molecular structures. The ester group adds versatility, allowing for further functionalization or hydrolysis to yield carboxylic acids. This compound is typically utilized as a building block in pharmaceutical and agrochemical synthesis, aiding in the development of bioactive molecules, including kinase inhibitors and other receptor modulators.
CAS Number | 1060814-91-6 |
Molecular Formula | C9H10BrNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(4-bromopyridin-2-yl)acetate |
InChI | InChI=1S/C9H10BrNO2/c1-2-13-9(12)6-8-5-7(10)3-4-11-8/h3-5H,2,6H2,1H3 |
InChIKey | UNQUMGSSWNEUIM-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |