For research use only. Not for therapeutic Use.
Ethyl 2-(6-bromopyridin-2-yl)acetate(CAT: L035371) is a high-purity brominated pyridine derivative featuring an ethyl acetate moiety. This versatile compound serves as a key intermediate in pharmaceutical and chemical research, particularly in the synthesis of heterocyclic frameworks and bioactive molecules. The 6-bromo substitution allows for targeted functionalization via cross-coupling reactions such as Suzuki, Heck, or Buchwald-Hartwig, facilitating the development of complex compounds. Its ester functionality enables further transformations, making it ideal for drug discovery, agrochemical development, and material science applications. Ethyl 2-(6-bromopyridin-2-yl)acetate combines excellent reactivity and stability, supporting precision-driven organic synthesis and innovative research.
CAS Number | 955369-63-8 |
Molecular Formula | C9H10BrNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(6-bromopyridin-2-yl)acetate |
InChI | InChI=1S/C9H10BrNO2/c1-2-13-9(12)6-7-4-3-5-8(10)11-7/h3-5H,2,6H2,1H3 |
InChIKey | LTRSPLNQOMJCSH-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC1=NC(=CC=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |