For research use only. Not for therapeutic Use.
Ethyl 2-amino-2-iminoacetate hydrochloride is an ethyl ester derivative with amino and imino functional groups, often used in pharmaceutical and organic synthesis. As a hydrochloride salt, it offers enhanced solubility, making it ideal for aqueous reactions. This compound serves as a versatile intermediate in the synthesis of heterocyclic compounds and bioactive molecules, especially for developing enzyme inhibitors and peptides. Its unique structure provides reactivity for various modifications, supporting applications in medicinal chemistry and complex organic molecule synthesis.
CAS Number | 76029-62-4 |
Molecular Formula | C4H9ClN2O2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-amino-2-iminoacetate;hydrochloride |
InChI | InChI=1S/C4H8N2O2.ClH/c1-2-8-4(7)3(5)6;/h2H2,1H3,(H3,5,6);1H |
InChIKey | ARUMINUDFDUGNU-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(=N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |