Home
>
Chemical Reagents>Organic Building Blocks> Ethyl 2-amino-3-(4-nitrophenyl)propanoate hydrochloride
For research use only. Not for therapeutic Use.
Ethyl 2-amino-3-(4-nitrophenyl)propanoate hydrochloride (Cat.No:L003933) is a vital chemical compound in pharmaceutical research. Its structure, combining an amino acid derivative with a nitrophenyl group, imparts unique reactivity. This compound serves as a key intermediate in the synthesis of specialized pharmaceuticals, particularly those with potential therapeutic applications.
Catalog Number | L003933 |
CAS Number | 163251-51-2 |
Molecular Formula | C11H15ClN2O4 |
Purity | ≥95% |
IUPAC Name | ethyl 2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
InChI | InChI=1S/C11H14N2O4.ClH/c1-2-17-11(14)10(12)7-8-3-5-9(6-4-8)13(15)16;/h3-6,10H,2,7,12H2,1H3;1H |
InChIKey | HHZUMTWHYNIFOC-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |