For research use only. Not for therapeutic Use.
Ethyl 2-(benzo[d]thiazol-2-yl)acetate(Cat No.:L048622)is a heterocyclic ester compound commonly used in organic synthesis and pharmaceutical research. Featuring a benzothiazole ring linked to an ethyl acetate group, this compound serves as a key intermediate in the development of various biologically active molecules, including potential drug candidates. Its structure allows for versatile reactivity, making it suitable for various chemical transformations, particularly in the synthesis of complex heterocyclic compounds. Researchers in medicinal chemistry and synthetic organic chemistry utilize this compound to create innovative therapies and advanced materials.
CAS Number | 29182-42-1 |
Molecular Formula | C11H11NO2S |
Purity | ≥95% |
IUPAC Name | ethyl 2-(1,3-benzothiazol-2-yl)acetate |
InChI | InChI=1S/C11H11NO2S/c1-2-14-11(13)7-10-12-8-5-3-4-6-9(8)15-10/h3-6H,2,7H2,1H3 |
InChIKey | VYMJUZXFYAREJY-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC1=NC2=CC=CC=C2S1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |