For research use only. Not for therapeutic Use.
Ethyl 2-bromo-1-methyl-1H-imidazole-4-carboxylate(Cat No.:L048991)is a high-purity compound widely used in pharmaceutical research and organic synthesis. This brominated imidazole derivative is an essential intermediate for developing bioactive molecules, particularly in the synthesis of complex heterocyclic compounds. Its structure, featuring both bromine and ester functionalities, allows for selective modifications, making it valuable in medicinal chemistry. Ethyl 2-bromo-1-methyl-1H-imidazole-4-carboxylate is crucial for research focused on creating new therapeutic agents and optimizing synthetic routes, offering reliable performance in advanced chemical applications.
CAS Number | 1639289-05-6 |
Molecular Formula | C7H9BrN2O2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-bromo-1-methylimidazole-4-carboxylate |
InChI | InChI=1S/C7H9BrN2O2/c1-3-12-6(11)5-4-10(2)7(8)9-5/h4H,3H2,1-2H3 |
InChIKey | FRFGCYPIOPYCIK-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CN(C(=N1)Br)C |