For research use only. Not for therapeutic Use.
Ethyl 2-bromo-4-fluoro-5-nitrobenzoate(Cat No.:L007346), is a vital organic compound used in various chemical applications. Its structure, consisting of a benzoate ester with bromine, fluorine, and nitro substituents, makes it valuable in pharmaceutical and agrochemical research. Researchers use it as a key building block in the synthesis of complex molecules, including pharmaceutical intermediates and active ingredients. This compound’s versatile reactivity allows chemists to explore diverse chemical transformations, enabling the creation of novel compounds for medicinal and agricultural purposes.
CAS Number | 1153284-99-1 |
Molecular Formula | C9H7BrFNO4 |
Purity | ≥95% |
IUPAC Name | ethyl 2-bromo-4-fluoro-5-nitrobenzoate |
InChI | InChI=1S/C9H7BrFNO4/c1-2-16-9(13)5-3-8(12(14)15)7(11)4-6(5)10/h3-4H,2H2,1H3 |
InChIKey | ULCUEMGHPKGASH-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=C(C=C1Br)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |