For research use only. Not for therapeutic Use.
Ethyl 2-bromooctanoate is a brominated ester commonly used as an intermediate in organic synthesis and pharmaceutical research. Featuring a bromo group on the second carbon of an octanoate chain, this compound serves as a versatile building block in the synthesis of complex molecules, especially for the development of bioactive compounds and agrochemicals. Its structure allows for various functional group transformations, making it valuable in reactions like Grignard and nucleophilic substitutions. This ester’s reactivity and stability support diverse applications in medicinal chemistry and material science.
CAS Number | 5445-29-4 |
Molecular Formula | C10H19BrO2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-bromooctanoate |
InChI | InChI=1S/C10H19BrO2/c1-3-5-6-7-8-9(11)10(12)13-4-2/h9H,3-8H2,1-2H3 |
InChIKey | JIQJOKSCSVMZAN-UHFFFAOYSA-N |
SMILES | CCCCCCC(C(=O)OCC)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |