For research use only. Not for therapeutic Use.
Ethyl 2-chloro-4-nitrobenzoate(Cat No.:L027334)is an ester derivative of benzoic acid, featuring a chlorine atom at the 2-position and a nitro group at the 4-position. This compound is important in pharmaceutical research and organic synthesis as an intermediate for the development of bioactive molecules, including potential drug candidates and agrochemicals. The nitro and chloro groups enhance the compound’s reactivity, allowing for diverse chemical modifications. The ester functionality also provides a handle for further transformations, making it valuable in medicinal chemistry and advanced chemical synthesis. High purity ensures consistent performance in research applications.
CAS Number | 73097-02-6 |
Molecular Formula | C9H8ClNO4 |
Purity | ≥95% |
IUPAC Name | ethyl 2-chloro-4-nitrobenzoate |
InChI | InChI=1S/C9H8ClNO4/c1-2-15-9(12)7-4-3-6(11(13)14)5-8(7)10/h3-5H,2H2,1H3 |
InChIKey | JFEBEHFIJNRGAT-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Cl |