Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate(Cat No.:L025041)is a chlorinated pyrimidine derivative commonly used in pharmaceutical and chemical research. This compound features a chlorine atom at the 2-position, methyl groups at the 4 and 6 positions, and an ethyl ester at the 5-position on the pyrimidine ring. It serves as a versatile building block for synthesizing bioactive molecules, including potential drug candidates. The compound’s unique structure allows for various chemical modifications, making it essential for researchers focused on innovative synthetic methodologies and advancing medicinal chemistry.
CAS Number | 108381-23-3 |
Molecular Formula | C9H11ClN2O2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate |
InChI | InChI=1S/C9H11ClN2O2/c1-4-14-8(13)7-5(2)11-9(10)12-6(7)3/h4H2,1-3H3 |
InChIKey | QWWCHVHQVYFMJU-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(N=C(N=C1C)Cl)C |