For research use only. Not for therapeutic Use.
Ethyl 2-chloroethoxyl acetic acid (Cat.No:M133611) is a chemical compound used in organic synthesis. It contains an ethyl ester group and a chlorine atom, making it versatile for creating various molecules. This compound may find applications in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
CAS Number | 17229-14-0 |
Molecular Formula | C6H11ClO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2-(2-chloroethoxy)acetate |
InChI | InChI=1S/C6H11ClO3/c1-2-10-6(8)5-9-4-3-7/h2-5H2,1H3 |
InChIKey | CVYKQPLWSDHSSV-UHFFFAOYSA-N |
SMILES | CCOC(=O)COCCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |