For research use only. Not for therapeutic Use.
Ethyl 2-(chloromethyl)-4-methylpyridine-3-carboxylate(Cat No.:L007585), is a chemical compound characterized by a pyridine ring substituted with a chloromethyl group at the 2-position and a carboxylate ester group at the 3-position. This specific structure is of interest in organic synthesis and medicinal chemistry. Scientists use it as a key intermediate for the preparation of complex molecules. Its versatility allows for various chemical modifications, making it valuable in the creation of diverse compounds for research purposes.
CAS Number | 1687855-47-5 |
Molecular Formula | C10H12ClNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(chloromethyl)-4-methylpyridine-3-carboxylate |
InChI | InChI=1S/C10H12ClNO2/c1-3-14-10(13)9-7(2)4-5-12-8(9)6-11/h4-5H,3,6H2,1-2H3 |
InChIKey | CWBKMOUAFFCXKG-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=CN=C1CCl)C |