For research use only. Not for therapeutic Use.
Ethyl 2-Cyanoacetate-13C 15N is a labeled chemical compound where the cyano group (–CN) contains both carbon-13 and nitrogen-15 isotopes. This compound is often used in research, particularly in studies involving synthesis and metabolic pathways. The isotopic labeling with 13C and 15N allows for precise tracking and analysis of the compound in chemical reactions and biological systems, especially using techniques like mass spectrometry and NMR spectroscopy. Ethyl 2-Cyanoacetate is commonly used as an intermediate in organic synthesis, and its labeled form is valuable for detailed mechanistic studies.
| Catalog Number | R018553 |
| CAS Number | 130442-98-7 |
| Synonyms | 2-Cyanoacetic Acid Ethyl Ester; (Ethoxycarbonyl)acetonitrile; Cyanoacetic Ester; Ethyl Cyanacetate; Malonic Acid Ethyl Ester Nitrile; NSC 8844; Ethyl α-Cyanoacetate; |
| Molecular Formula | C5H7NO2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | ethyl 2-(azanylidynemethyl)acetate |
| InChI | InChI=1S/C5H7NO2/c1-2-8-5(7)3-4-6/h2-3H2,1H3/i4+1,6+1 |
| InChIKey | ZIUSEGSNTOUIPT-UHJUODCXSA-N |
| SMILES | CCOC(=O)CC#N |
